Air Pollution

The Right of Children to Free and Compulsory Education (Right To Education) Act,$2009,$ has made free education for all children between the age of _____.

Unburnt carbon particles are dangerous pollutants causing respiratory diseases.

Name the fuels which cause respiratory disease.

What are the negative consequences of burning fossil fuels?

Choose the sources of air pollutants from the following options.

What are air pollution and list some natural sources of air pollutants?

The ozone layer of the earth is useful for living beings because:

Possible causes of ozone depletion in the stratosphere include:

1. The various combustion products emitted from high flying supersonic aircraft

2. Nitrous oxide released from nitrogenous chemical ferti I i sers

3. Chlorine atoms that react with and destroy the ozone in the troposphere

4. Chlorofluorocarbons used in aerosol spray cans, refrigerant systems.

Consider the following sentences with reference to the historic amendment to the Montreal Protocol adopted in Kigali in October, 2016.
1. By implementing the kigali Amendment, the world can avoid up to 0.5° C of global wam1ing by the end of the century.
2. The Kigali Amendment is the most significant climate mitigation step the world has taken since the ratifica-tion of the Paris Agreement.
3. The Kigali Amendment to the montreal Protocol is legally binding and will come into force from 1 Janu-ary 2019.
Which of the statements given above is/ are correct?

Which of the following is a source of emissions leading to the eventual formation of surface ozone as a pollutant?

Supersonic jet causes pollution by thinning of _____.

Which one of the following is related to ozone formation?

The Ozone layer restricts _____.

Which among the following pollutants is a secondary pollutant?

Which of the following synthetic chemical is responsible for ozone layer depletion?

Which among the following is the prime source of chlorofluorocarbons(CFCs)?

My grandmother tells me that winters were colder in the past than now-a days. Why climate has changed?

Which environmental phenomenon has been linked to synthetic chemicals like chlorofluorocarbons (CFCs)?

Find out the names of top ten polluted cities of the world. Take the political map of the world and mark them.

When smoke from the burning substances combines with the fog, it forms _____.